C31H45N3O4 — CID 56846772
[(5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(3R)-3-aminopyrrolidin-1-yl]ethyl]carbamate (PubChem CID 56846772) has the molecular formula C31H45N3O4 and a molecular weight of 523.72 g/mol. Its IUPAC name is [(5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(3R)-3-aminopyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | [(5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(3R)-3-aminopyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 56846772 |
| Molecular Formula | C31H45N3O4 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | [(5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(3R)-3-aminopyrrolidin-1-yl]ethyl]carbamate |
| SMILES | C[C@]12CCC(OC(=O)NCCN3CC[C@@H](N)C3)C[C@H]1CC[C@H]1C3=CC[C@H](c4ccc(=O)oc4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C31H45N3O4/c1-30-12-9-23(38-29(36)33-14-16-34-15-11-22(32)18-34)17-21(30)4-5-24-26-7-6-25(20-3-8-28(35)37-19-20)31(26,2)13-10-27(24)30/h3,7-8,19,21-25,27H,4-6,9-18,32H2,1-2H3,(H,33,36)/t21-,22-,23?,24+,25-,27+,30+,31-/m1/s1 |
| InChIKey | OMPPLXIIWYPDFS-LXZIHTPASA-N |
| XLogP | 4.81 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|