C27H38O6 — CID 124920327
[(3R,5R,10S,13R,14R,17S)-11-acetyloxy-17-[(1R)-1-acetyloxyethyl]-10,13-dimethyl-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 124920327) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is [(3R,5R,10S,13R,14R,17S)-11-acetyloxy-17-[(1R)-1-acetyloxyethyl]-10,13-dimethyl-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5R,10S,13R,14R,17S)-11-acetyloxy-17-[(1R)-1-acetyloxyethyl]-10,13-dimethyl-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 124920327 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | [(3R,5R,10S,13R,14R,17S)-11-acetyloxy-17-[(1R)-1-acetyloxyethyl]-10,13-dimethyl-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1=C2C(=CC[C@@H]3C[C@H](OC(C)=O)CC[C@]23C)[C@@H]2CC[C@H]([C@@H](C)OC(C)=O)[C@]2(C)C1 |
| InChI | InChI=1S/C27H38O6/c1-15(31-16(2)28)22-9-10-23-21-8-7-19-13-20(32-17(3)29)11-12-26(19,5)25(21)24(33-18(4)30)14-27(22,23)6/h8,15,19-20,22-23H,7,9-14H2,1-6H3/t15-,19-,20-,22-,23+,26+,27+/m1/s1 |
| InChIKey | BTYALRODHXHJKS-RCWLWDLUSA-N |
| XLogP | 5.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|