C35H52O3 — CID 99600730
[(1R,2R,4S,6R,7R,10S,11S,14S,16S)-6-[(2R,5S)-5,6-dimethylheptan-2-yl]-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] benzoate (PubChem CID 99600730) has the molecular formula C35H52O3 and a molecular weight of 520.80 g/mol. Its IUPAC name is [(1R,2R,4S,6R,7R,10S,11S,14S,16S)-6-[(2R,5S)-5,6-dimethylheptan-2-yl]-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] benzoate.
| Compound Name | [(1R,2R,4S,6R,7R,10S,11S,14S,16S)-6-[(2R,5S)-5,6-dimethylheptan-2-yl]-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] benzoate |
|---|---|
| PubChem CID | 99600730 |
| Molecular Formula | C35H52O3 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | [(1R,2R,4S,6R,7R,10S,11S,14S,16S)-6-[(2R,5S)-5,6-dimethylheptan-2-yl]-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] benzoate |
| SMILES | CC(C)[C@@H](C)CC[C@@H](C)[C@H]1C[C@@H]2O[C@@]23[C@@H]2CC[C@H]4C[C@@H](OC(=O)c5ccccc5)CC[C@]4(C)[C@H]2CC[C@]13C |
| InChI | InChI=1S/C35H52O3/c1-22(2)23(3)12-13-24(4)30-21-31-35(38-31)29-15-14-26-20-27(37-32(36)25-10-8-7-9-11-25)16-18-33(26,5)28(29)17-19-34(30,35)6/h7-11,22-24,26-31H,12-21H2,1-6H3/t23-,24+,26-,27-,28-,29+,30+,31-,33-,34+,35-/m0/s1 |
| InChIKey | HZLYNDPBZTUNLK-YLPOXAQESA-N |
| XLogP | 8.71 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|