C23H33BrO5 — CID 45043646
[(5S,9R)-17-acetyloxy-9-bromo-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 45043646) has the molecular formula C23H33BrO5 and a molecular weight of 469.42 g/mol. Its IUPAC name is [(5S,9R)-17-acetyloxy-9-bromo-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(5S,9R)-17-acetyloxy-9-bromo-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 45043646 |
| Molecular Formula | C23H33BrO5 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [(5S,9R)-17-acetyloxy-9-bromo-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)[C@@H](CCC3C4CCC(OC(C)=O)C4(C)CC(=O)[C@@]32Br)C1 |
| InChI | InChI=1S/C23H33BrO5/c1-13(25)28-16-9-10-22(4)15(11-16)5-6-18-17-7-8-20(29-14(2)26)21(17,3)12-19(27)23(18,22)24/h15-18,20H,5-12H2,1-4H3/t15-,16?,17?,18?,20?,21?,22?,23-/m0/s1 |
| InChIKey | BDKULZHATVOEAZ-FBIRDNOJSA-N |
| XLogP | 4.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|