C20H24O2 — CID 139249581
[(1R,8S)-9-methylidene-4-tricyclo[6.2.2.01,6]dodecanyl] benzoate (PubChem CID 139249581) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(1R,8S)-9-methylidene-4-tricyclo[6.2.2.01,6]dodecanyl] benzoate.
| Compound Name | [(1R,8S)-9-methylidene-4-tricyclo[6.2.2.01,6]dodecanyl] benzoate |
|---|---|
| PubChem CID | 139249581 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | [(1R,8S)-9-methylidene-4-tricyclo[6.2.2.01,6]dodecanyl] benzoate |
| SMILES | C=C1C[C@@]23CCC(OC(=O)c4ccccc4)CC2C[C@@H]1CC3 |
| InChI | InChI=1S/C20H24O2/c1-14-13-20-9-7-16(14)11-17(20)12-18(8-10-20)22-19(21)15-5-3-2-4-6-15/h2-6,16-18H,1,7-13H2/t16-,17?,18?,20+/m0/s1 |
| InChIKey | CDDPPCLFJJMHIS-USWSCHJFSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|