C19H20O3 — CID 11055549
[(1S,2S,6S,8S)-11-oxo-2-tricyclo[6.3.1.01,6]dodec-4-enyl] benzoate (PubChem CID 11055549) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is [(1S,2S,6S,8S)-11-oxo-2-tricyclo[6.3.1.01,6]dodec-4-enyl] benzoate.
| Compound Name | [(1S,2S,6S,8S)-11-oxo-2-tricyclo[6.3.1.01,6]dodec-4-enyl] benzoate |
|---|---|
| PubChem CID | 11055549 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(1S,2S,6S,8S)-11-oxo-2-tricyclo[6.3.1.01,6]dodec-4-enyl] benzoate |
| SMILES | O=C(O[C@H]1CC=C[C@@H]2C[C@@H]3CCC(=O)[C@@]21C3)c1ccccc1 |
| InChI | InChI=1S/C19H20O3/c20-16-10-9-13-11-15-7-4-8-17(19(15,16)12-13)22-18(21)14-5-2-1-3-6-14/h1-7,13,15,17H,8-12H2/t13-,15+,17-,19+/m0/s1 |
| InChIKey | HYIVPEKDDVYCIJ-OIWLHUINSA-N |
| XLogP | 3.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|