C22H24FNO8 — CID 118147363
benzyl [(1Z,2R,3R,4R)-2-fluoro-4-hydroxy-1-methoxyimino-5-phenylmethoxycarbonyloxypentan-3-yl] carbonate (PubChem CID 118147363) has the molecular formula C22H24FNO8 and a molecular weight of 449.43 g/mol. Its IUPAC name is benzyl [(1Z,2R,3R,4R)-2-fluoro-4-hydroxy-1-methoxyimino-5-phenylmethoxycarbonyloxypentan-3-yl] carbonate.
| Compound Name | benzyl [(1Z,2R,3R,4R)-2-fluoro-4-hydroxy-1-methoxyimino-5-phenylmethoxycarbonyloxypentan-3-yl] carbonate |
|---|---|
| PubChem CID | 118147363 |
| Molecular Formula | C22H24FNO8 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | benzyl [(1Z,2R,3R,4R)-2-fluoro-4-hydroxy-1-methoxyimino-5-phenylmethoxycarbonyloxypentan-3-yl] carbonate |
| SMILES | CO/N=C\[C@@H](F)[C@H](OC(=O)OCc1ccccc1)[C@H](O)COC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H24FNO8/c1-28-24-12-18(23)20(32-22(27)30-14-17-10-6-3-7-11-17)19(25)15-31-21(26)29-13-16-8-4-2-5-9-16/h2-12,18-20,25H,13-15H2,1H3/b24-12-/t18-,19-,20+/m1/s1 |
| InChIKey | ZCFYITLUGKAUFT-HRVIIYCQSA-N |
| XLogP | 3.39 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|