C13H13F4NO3 — CID 129299723
[(2S,4S)-4-fluoro-2-hydroxy-5-iminopentyl] 4-(trifluoromethyl)benzoate (PubChem CID 129299723) has the molecular formula C13H13F4NO3 and a molecular weight of 307.24 g/mol. Its IUPAC name is [(2S,4S)-4-fluoro-2-hydroxy-5-iminopentyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(2S,4S)-4-fluoro-2-hydroxy-5-iminopentyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 129299723 |
| Molecular Formula | C13H13F4NO3 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | [(2S,4S)-4-fluoro-2-hydroxy-5-iminopentyl] 4-(trifluoromethyl)benzoate |
| SMILES | [H]/N=C/[C@@H](F)C[C@H](O)COC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F4NO3/c14-10(6-18)5-11(19)7-21-12(20)8-1-3-9(4-2-8)13(15,16)17/h1-4,6,10-11,18-19H,5,7H2/b18-6+/t10-,11-/m0/s1 |
| InChIKey | WBMXPPQTMGKDJT-WIJDNPILSA-N |
| XLogP | 2.60 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|