C18H14Cl3FN2O6S — CID 129299926
[(2S,4S)-4-fluoro-5-imino-2-(2,4,5-trichlorophenyl)sulfinyloxypentyl] 4-nitrobenzoate (PubChem CID 129299926) has the molecular formula C18H14Cl3FN2O6S and a molecular weight of 511.74 g/mol. Its IUPAC name is [(2S,4S)-4-fluoro-5-imino-2-(2,4,5-trichlorophenyl)sulfinyloxypentyl] 4-nitrobenzoate.
| Compound Name | [(2S,4S)-4-fluoro-5-imino-2-(2,4,5-trichlorophenyl)sulfinyloxypentyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 129299926 |
| Molecular Formula | C18H14Cl3FN2O6S |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 509.96 |
| IUPAC Name | [(2S,4S)-4-fluoro-5-imino-2-(2,4,5-trichlorophenyl)sulfinyloxypentyl] 4-nitrobenzoate |
| SMILES | [H]/N=C/[C@@H](F)C[C@@H](COC(=O)c1ccc([N+](=O)[O-])cc1)OS(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl3FN2O6S/c19-14-6-16(21)17(7-15(14)20)31(28)30-13(5-11(22)8-23)9-29-18(25)10-1-3-12(4-2-10)24(26)27/h1-4,6-8,11,13,23H,5,9H2/b23-8+/t11-,13-,31?/m0/s1 |
| InChIKey | OWKXSBVCCIJPAQ-NRGQBHAWSA-N |
| XLogP | 5.20 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|