C20H16BrClFN3O9 — CID 140945607
[(1Z,2R,3S,4S)-4-bromo-2-fluoro-1-methoxyimino-5-(4-nitrobenzoyl)oxypentan-3-yl] 2-chloro-4-nitrobenzoate (PubChem CID 140945607) has the molecular formula C20H16BrClFN3O9 and a molecular weight of 576.72 g/mol. Its IUPAC name is [(1Z,2R,3S,4S)-4-bromo-2-fluoro-1-methoxyimino-5-(4-nitrobenzoyl)oxypentan-3-yl] 2-chloro-4-nitrobenzoate.
| Compound Name | [(1Z,2R,3S,4S)-4-bromo-2-fluoro-1-methoxyimino-5-(4-nitrobenzoyl)oxypentan-3-yl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 140945607 |
| Molecular Formula | C20H16BrClFN3O9 |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 574.97 |
| IUPAC Name | [(1Z,2R,3S,4S)-4-bromo-2-fluoro-1-methoxyimino-5-(4-nitrobenzoyl)oxypentan-3-yl] 2-chloro-4-nitrobenzoate |
| SMILES | CO/N=C\[C@@H](F)[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1Cl)[C@@H](Br)COC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H16BrClFN3O9/c1-33-24-9-17(23)18(35-20(28)14-7-6-13(26(31)32)8-16(14)22)15(21)10-34-19(27)11-2-4-12(5-3-11)25(29)30/h2-9,15,17-18H,10H2,1H3/b24-9-/t15-,17+,18+/m0/s1 |
| InChIKey | YACKSMWAZSSBCJ-WWVGOUJFSA-N |
| XLogP | 4.27 |
| TPSA | 160.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|