C14H18FNO3 — CID 129299960
[(2S,4S)-4-fluoro-2-hydroxy-5-iminopentyl] 3,5-dimethylbenzoate (PubChem CID 129299960) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is [(2S,4S)-4-fluoro-2-hydroxy-5-iminopentyl] 3,5-dimethylbenzoate.
| Compound Name | [(2S,4S)-4-fluoro-2-hydroxy-5-iminopentyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 129299960 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [(2S,4S)-4-fluoro-2-hydroxy-5-iminopentyl] 3,5-dimethylbenzoate |
| SMILES | [H]/N=C/[C@@H](F)C[C@H](O)COC(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H18FNO3/c1-9-3-10(2)5-11(4-9)14(18)19-8-13(17)6-12(15)7-16/h3-5,7,12-13,16-17H,6,8H2,1-2H3/b16-7+/t12-,13-/m0/s1 |
| InChIKey | BCCRHTNJUXNWPQ-WPJXSRQUSA-N |
| XLogP | 2.20 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|