C23H29BrFNO4 — CID 144573226
4-bromo-2-fluorobutan-1-imine;3,5-dimethylbenzoic acid;methyl 3,5-dimethylbenzoate (PubChem CID 144573226) has the molecular formula C23H29BrFNO4 and a molecular weight of 482.39 g/mol. Its IUPAC name is 4-bromo-2-fluorobutan-1-imine;3,5-dimethylbenzoic acid;methyl 3,5-dimethylbenzoate.
| Compound Name | 4-bromo-2-fluorobutan-1-imine;3,5-dimethylbenzoic acid;methyl 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 144573226 |
| Molecular Formula | C23H29BrFNO4 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 4-bromo-2-fluorobutan-1-imine;3,5-dimethylbenzoic acid;methyl 3,5-dimethylbenzoate |
| SMILES | COC(=O)c1cc(C)cc(C)c1.Cc1cc(C)cc(C(=O)O)c1.[H]/N=C/C(F)CCBr |
| InChI | InChI=1S/C10H12O2.C9H10O2.C4H7BrFN/c1-7-4-8(2)6-9(5-7)10(11)12-3;1-6-3-7(2)5-8(4-6)9(10)11;5-2-1-4(6)3-7/h4-6H,1-3H3;3-5H,1-2H3,(H,10,11);3-4,7H,1-2H2/b;;7-3+ |
| InChIKey | XQMCXOSZFVCZCN-ZBDZEAQZSA-N |
| XLogP | 5.85 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|