C12H11BrCl2FNO2 — CID 129299939
[(2R,4S)-2-bromo-4-fluoro-5-iminopentyl] 2,4-dichlorobenzoate (PubChem CID 129299939) has the molecular formula C12H11BrCl2FNO2 and a molecular weight of 371.03 g/mol. Its IUPAC name is [(2R,4S)-2-bromo-4-fluoro-5-iminopentyl] 2,4-dichlorobenzoate.
| Compound Name | [(2R,4S)-2-bromo-4-fluoro-5-iminopentyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 129299939 |
| Molecular Formula | C12H11BrCl2FNO2 |
| Molecular Weight | 371.03 g/mol |
| Exact Mass | 368.93 |
| IUPAC Name | [(2R,4S)-2-bromo-4-fluoro-5-iminopentyl] 2,4-dichlorobenzoate |
| SMILES | [H]/N=C/[C@@H](F)C[C@@H](Br)COC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11BrCl2FNO2/c13-7(3-9(16)5-17)6-19-12(18)10-2-1-8(14)4-11(10)15/h1-2,4-5,7,9,17H,3,6H2/b17-5+/t7-,9+/m1/s1 |
| InChIKey | GYJVGOMLANVXNR-JXASVEIISA-N |
| XLogP | 4.29 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.03 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|