C13H7F9O5 — CID 162508993
2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2,4,6-trifluorobenzoate (PubChem CID 162508993) has the molecular formula C13H7F9O5 and a molecular weight of 414.18 g/mol. Its IUPAC name is 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2,4,6-trifluorobenzoate.
| Compound Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2,4,6-trifluorobenzoate |
|---|---|
| PubChem CID | 162508993 |
| Molecular Formula | C13H7F9O5 |
| Molecular Weight | 414.18 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2,4,6-trifluorobenzoate |
| SMILES | O=C(OCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H7F9O5/c14-5-3-6(15)8(7(16)4-5)9(23)26-1-2-27-10(24)11(25,12(17,18)19)13(20,21)22/h3-4,25H,1-2H2 |
| InChIKey | ZKACWHGNHLEFQY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|