C9H10F6O5 — CID 174178872
2-(2-oxopropoxy)ethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (PubChem CID 174178872) has the molecular formula C9H10F6O5 and a molecular weight of 312.16 g/mol. Its IUPAC name is 2-(2-oxopropoxy)ethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
| Compound Name | 2-(2-oxopropoxy)ethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 174178872 |
| Molecular Formula | C9H10F6O5 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-(2-oxopropoxy)ethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| SMILES | CC(=O)COCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10F6O5/c1-5(16)4-19-2-3-20-6(17)7(18,8(10,11)12)9(13,14)15/h18H,2-4H2,1H3 |
| InChIKey | QTRULYHYSGZHBA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|