About 2-(2-oxopropoxy)ethyl carbonochloridate
2-(2-oxopropoxy)ethyl carbonochloridate (PubChem CID 165028645) has the molecular formula C6H9ClO4
and a molecular weight of 180.59 g/mol. Its IUPAC name is 2-(2-oxopropoxy)ethyl carbonochloridate.
Molecular Properties
| Compound Name | 2-(2-oxopropoxy)ethyl carbonochloridate |
| PubChem CID | 165028645 |
| Molecular Formula | C6H9ClO4 |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 2-(2-oxopropoxy)ethyl carbonochloridate |
| SMILES | CC(=O)COCCOC(=O)Cl |
| InChI | InChI=1S/C6H9ClO4/c1-5(8)4-10-2-3-11-6(7)9/h2-4H2,1H3 |
| InChIKey | CHEVAMWKGHSHNN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-oxopropoxy)ethyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxopropoxy)ethyl carbonochloridate?
The IUPAC name of 2-(2-oxopropoxy)ethyl carbonochloridate (CID 165028645) is 2-(2-oxopropoxy)ethyl carbonochloridate.
What is the SMILES notation for 2-(2-oxopropoxy)ethyl carbonochloridate?
The canonical SMILES for 2-(2-oxopropoxy)ethyl carbonochloridate is CC(=O)COCCOC(=O)Cl.
What is the InChIKey of 2-(2-oxopropoxy)ethyl carbonochloridate?
The InChIKey is CHEVAMWKGHSHNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO4/c1-5(8)4-10-2-3-11-6(7)9/h2-4H2,1H3.
What are the key properties of 2-(2-oxopropoxy)ethyl carbonochloridate?
2-(2-oxopropoxy)ethyl carbonochloridate has a molecular weight of 180.59 g/mol, XLogP of 0.97, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxopropoxy)ethyl carbonochloridate is sourced from PubChem (CID 165028645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).