C9H17NO5 — CID 155596113
N-(2-hydroxyethyl)-2-[2-(2-oxopropoxy)ethoxy]acetamide (PubChem CID 155596113) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[2-(2-oxopropoxy)ethoxy]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[2-(2-oxopropoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 155596113 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[2-(2-oxopropoxy)ethoxy]acetamide |
| SMILES | CC(=O)COCCOCC(=O)NCCO |
| InChI | InChI=1S/C9H17NO5/c1-8(12)6-14-4-5-15-7-9(13)10-2-3-11/h11H,2-7H2,1H3,(H,10,13) |
| InChIKey | QRXKNHIQABRQFB-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|