C8H15N2O5Y- — CID 155596009
[2-[2-[2-(2-hydroxyethylamino)-2-oxoethoxy]ethoxy]acetyl]azanide;yttrium (PubChem CID 155596009) has the molecular formula C8H15N2O5Y- and a molecular weight of 308.12 g/mol. Its IUPAC name is [2-[2-[2-(2-hydroxyethylamino)-2-oxoethoxy]ethoxy]acetyl]azanide;yttrium.
| Compound Name | [2-[2-[2-(2-hydroxyethylamino)-2-oxoethoxy]ethoxy]acetyl]azanide;yttrium |
|---|---|
| PubChem CID | 155596009 |
| Molecular Formula | C8H15N2O5Y- |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | [2-[2-[2-(2-hydroxyethylamino)-2-oxoethoxy]ethoxy]acetyl]azanide;yttrium |
| SMILES | [NH-]C(=O)COCCOCC(=O)NCCO.[Y] |
| InChI | InChI=1S/C8H16N2O5.Y/c9-7(12)5-14-3-4-15-6-8(13)10-1-2-11;/h11H,1-6H2,(H3,9,10,12,13);/p-1 |
| InChIKey | XVDDYCRLFKIYDA-UHFFFAOYSA-M |
| XLogP | -1.30 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|