C8H19N3O4 — CID 123205236
2-[2-(2-hydrazinylethoxy)ethoxy]-N-(2-hydroxyethyl)acetamide (PubChem CID 123205236) has the molecular formula C8H19N3O4 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-[2-(2-hydrazinylethoxy)ethoxy]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[2-(2-hydrazinylethoxy)ethoxy]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 123205236 |
| Molecular Formula | C8H19N3O4 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[2-(2-hydrazinylethoxy)ethoxy]-N-(2-hydroxyethyl)acetamide |
| SMILES | NNCCOCCOCC(=O)NCCO |
| InChI | InChI=1S/C8H19N3O4/c9-11-2-4-14-5-6-15-7-8(13)10-1-3-12/h11-12H,1-7,9H2,(H,10,13) |
| InChIKey | UJMXXYJGSZXXMT-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|