C13H7F7IO5- — CID 162508572
1,1,1,3,3,3-hexafluoro-2-[2-(2-fluoro-4-iodobenzoyl)oxyethoxycarbonyl]propan-2-olate (PubChem CID 162508572) has the molecular formula C13H7F7IO5- and a molecular weight of 503.08 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-(2-fluoro-4-iodobenzoyl)oxyethoxycarbonyl]propan-2-olate.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-(2-fluoro-4-iodobenzoyl)oxyethoxycarbonyl]propan-2-olate |
|---|---|
| PubChem CID | 162508572 |
| Molecular Formula | C13H7F7IO5- |
| Molecular Weight | 503.08 g/mol |
| Exact Mass | 502.92 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-(2-fluoro-4-iodobenzoyl)oxyethoxycarbonyl]propan-2-olate |
| SMILES | O=C(OCCOC(=O)C([O-])(C(F)(F)F)C(F)(F)F)c1ccc(I)cc1F |
| InChI | InChI=1S/C13H7F7IO5/c14-8-5-6(21)1-2-7(8)9(22)25-3-4-26-10(23)11(24,12(15,16)17)13(18,19)20/h1-2,5H,3-4H2/q-1 |
| InChIKey | LRABRHJLIOVHJB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.08 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|