C13H8BrF6O5- — CID 162509361
2-[2-(3-bromobenzoyl)oxyethoxycarbonyl]-1,1,1,3,3,3-hexafluoropropan-2-olate (PubChem CID 162509361) has the molecular formula C13H8BrF6O5- and a molecular weight of 438.09 g/mol. Its IUPAC name is 2-[2-(3-bromobenzoyl)oxyethoxycarbonyl]-1,1,1,3,3,3-hexafluoropropan-2-olate.
| Compound Name | 2-[2-(3-bromobenzoyl)oxyethoxycarbonyl]-1,1,1,3,3,3-hexafluoropropan-2-olate |
|---|---|
| PubChem CID | 162509361 |
| Molecular Formula | C13H8BrF6O5- |
| Molecular Weight | 438.09 g/mol |
| Exact Mass | 436.95 |
| IUPAC Name | 2-[2-(3-bromobenzoyl)oxyethoxycarbonyl]-1,1,1,3,3,3-hexafluoropropan-2-olate |
| SMILES | O=C(OCCOC(=O)C([O-])(C(F)(F)F)C(F)(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H8BrF6O5/c14-8-3-1-2-7(6-8)9(21)24-4-5-25-10(22)11(23,12(15,16)17)13(18,19)20/h1-3,6H,4-5H2/q-1 |
| InChIKey | ODLYDTOQONHSJU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.09 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|