About propyl 3-bromobenzoate;sulfuryl dichloride
propyl 3-bromobenzoate;sulfuryl dichloride (PubChem CID 174381854) has the molecular formula C10H11BrCl2O4S
and a molecular weight of 378.07 g/mol. Its IUPAC name is propyl 3-bromobenzoate;sulfuryl dichloride.
Molecular Properties
| Compound Name | propyl 3-bromobenzoate;sulfuryl dichloride |
| PubChem CID | 174381854 |
| Molecular Formula | C10H11BrCl2O4S |
| Molecular Weight | 378.07 g/mol |
| Exact Mass | 375.89 |
| IUPAC Name | propyl 3-bromobenzoate;sulfuryl dichloride |
| SMILES | CCCOC(=O)c1cccc(Br)c1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C10H11BrO2.Cl2O2S/c1-2-6-13-10(12)8-4-3-5-9(11)7-8;1-5(2,3)4/h3-5,7H,2,6H2,1H3; |
| InChIKey | CQJHSOWMOWAIFL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.07 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propyl 3-bromobenzoate;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-bromobenzoate;sulfuryl dichloride?
The IUPAC name of propyl 3-bromobenzoate;sulfuryl dichloride (CID 174381854) is propyl 3-bromobenzoate;sulfuryl dichloride.
What is the SMILES notation for propyl 3-bromobenzoate;sulfuryl dichloride?
The canonical SMILES for propyl 3-bromobenzoate;sulfuryl dichloride is CCCOC(=O)c1cccc(Br)c1.O=S(=O)(Cl)Cl.
What is the InChIKey of propyl 3-bromobenzoate;sulfuryl dichloride?
The InChIKey is CQJHSOWMOWAIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO2.Cl2O2S/c1-2-6-13-10(12)8-4-3-5-9(11)7-8;1-5(2,3)4/h3-5,7H,2,6H2,1H3;.
What are the key properties of propyl 3-bromobenzoate;sulfuryl dichloride?
propyl 3-bromobenzoate;sulfuryl dichloride has a molecular weight of 378.07 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-bromobenzoate;sulfuryl dichloride is sourced from PubChem (CID 174381854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).