C14H11F9O5 — CID 166910184
2-[hydroxy-[4-(trifluoromethyl)phenyl]methoxy]ethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (PubChem CID 166910184) has the molecular formula C14H11F9O5 and a molecular weight of 430.22 g/mol. Its IUPAC name is 2-[hydroxy-[4-(trifluoromethyl)phenyl]methoxy]ethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
| Compound Name | 2-[hydroxy-[4-(trifluoromethyl)phenyl]methoxy]ethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 166910184 |
| Molecular Formula | C14H11F9O5 |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 2-[hydroxy-[4-(trifluoromethyl)phenyl]methoxy]ethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| SMILES | O=C(OCCOC(O)c1ccc(C(F)(F)F)cc1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H11F9O5/c15-12(16,17)8-3-1-7(2-4-8)9(24)27-5-6-28-10(25)11(26,13(18,19)20)14(21,22)23/h1-4,9,24,26H,5-6H2 |
| InChIKey | KNLOPEZIWVDSBA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|