C18H14O3S — CID 14922311
2-(3-phenylsulfanylpropanoyl)indene-1,3-dione (PubChem CID 14922311) has the molecular formula C18H14O3S and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-(3-phenylsulfanylpropanoyl)indene-1,3-dione.
| Compound Name | 2-(3-phenylsulfanylpropanoyl)indene-1,3-dione |
|---|---|
| PubChem CID | 14922311 |
| Molecular Formula | C18H14O3S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-(3-phenylsulfanylpropanoyl)indene-1,3-dione |
| SMILES | O=C(CCSc1ccccc1)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14O3S/c19-15(10-11-22-12-6-2-1-3-7-12)16-17(20)13-8-4-5-9-14(13)18(16)21/h1-9,16H,10-11H2 |
| InChIKey | SHUOTUAAKWWVQV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|