C21H18N2O3S — CID 91110719
2-[[(2R)-2-amino-3-pyren-1-ylsulfanylpropanoyl]amino]acetic acid (PubChem CID 91110719) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-pyren-1-ylsulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-amino-3-pyren-1-ylsulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 91110719 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-[[(2R)-2-amino-3-pyren-1-ylsulfanylpropanoyl]amino]acetic acid |
| SMILES | N[C@@H](CSc1ccc2ccc3cccc4ccc1c2c34)C(=O)NCC(=O)O |
| InChI | InChI=1S/C21H18N2O3S/c22-16(21(26)23-10-18(24)25)11-27-17-9-7-14-5-4-12-2-1-3-13-6-8-15(17)20(14)19(12)13/h1-9,16H,10-11,22H2,(H,23,26)(H,24,25)/t16-/m0/s1 |
| InChIKey | ATWFIHYGZXWITQ-INIZCTEOSA-N |
| XLogP | 3.20 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|