C13H19N3O5S — CID 10640083
2-[[(2R)-2-amino-3-[5-(2-aminoethyl)-2,3-dihydroxyphenyl]sulfanylpropanoyl]amino]acetic acid (PubChem CID 10640083) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-[5-(2-aminoethyl)-2,3-dihydroxyphenyl]sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-amino-3-[5-(2-aminoethyl)-2,3-dihydroxyphenyl]sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 10640083 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[[(2R)-2-amino-3-[5-(2-aminoethyl)-2,3-dihydroxyphenyl]sulfanylpropanoyl]amino]acetic acid |
| SMILES | NCCc1cc(O)c(O)c(SC[C@H](N)C(=O)NCC(=O)O)c1 |
| InChI | InChI=1S/C13H19N3O5S/c14-2-1-7-3-9(17)12(20)10(4-7)22-6-8(15)13(21)16-5-11(18)19/h3-4,8,17,20H,1-2,5-6,14-15H2,(H,16,21)(H,18,19)/t8-/m0/s1 |
| InChIKey | PFDOMDWPRBOTDN-QMMMGPOBSA-N |
| XLogP | -0.78 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|