C14H21N3O6S2 — CID 71349938
(2R)-2-amino-3-[4-[(2R)-2-amino-2-carboxyethyl]sulfanyl-5-(2-aminoethyl)-2,3-dihydroxyphenyl]sulfanylpropanoic acid (PubChem CID 71349938) has the molecular formula C14H21N3O6S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2R)-2-amino-3-[4-[(2R)-2-amino-2-carboxyethyl]sulfanyl-5-(2-aminoethyl)-2,3-dihydroxyphenyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[4-[(2R)-2-amino-2-carboxyethyl]sulfanyl-5-(2-aminoethyl)-2,3-dihydroxyphenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 71349938 |
| Molecular Formula | C14H21N3O6S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (2R)-2-amino-3-[4-[(2R)-2-amino-2-carboxyethyl]sulfanyl-5-(2-aminoethyl)-2,3-dihydroxyphenyl]sulfanylpropanoic acid |
| SMILES | NCCc1cc(SC[C@H](N)C(=O)O)c(O)c(O)c1SC[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H21N3O6S2/c15-2-1-6-3-9(24-4-7(16)13(20)21)10(18)11(19)12(6)25-5-8(17)14(22)23/h3,7-8,18-19H,1-2,4-5,15-17H2,(H,20,21)(H,22,23)/t7-,8-/m0/s1 |
| InChIKey | BQMVZBGSUJELKK-YUMQZZPRSA-N |
| XLogP | -0.39 |
| TPSA | 193.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|