C11H17N3O4 — CID 166986751
2-amino-N-[2-(4-amino-3,5-dihydroxyphenyl)ethyl]-3-hydroxypropanamide (PubChem CID 166986751) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-amino-N-[2-(4-amino-3,5-dihydroxyphenyl)ethyl]-3-hydroxypropanamide.
| Compound Name | 2-amino-N-[2-(4-amino-3,5-dihydroxyphenyl)ethyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 166986751 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-amino-N-[2-(4-amino-3,5-dihydroxyphenyl)ethyl]-3-hydroxypropanamide |
| SMILES | Nc1c(O)cc(CCNC(=O)C(N)CO)cc1O |
| InChI | InChI=1S/C11H17N3O4/c12-7(5-15)11(18)14-2-1-6-3-8(16)10(13)9(17)4-6/h3-4,7,15-17H,1-2,5,12-13H2,(H,14,18) |
| InChIKey | XWOYCYDYKIFOQT-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|