About 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide
2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide (PubChem CID 166986947) has the molecular formula C12H18N2O5
and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide.
Molecular Properties
| Compound Name | 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide |
| PubChem CID | 166986947 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide |
| SMILES | COc1c(O)cc(CCNC(=O)C(N)CO)cc1O |
| InChI | InChI=1S/C12H18N2O5/c1-19-11-9(16)4-7(5-10(11)17)2-3-14-12(18)8(13)6-15/h4-5,8,15-17H,2-3,6,13H2,1H3,(H,14,18) |
| InChIKey | VQDVRRHFKRMVEV-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide?
The IUPAC name of 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide (CID 166986947) is 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide.
What is the SMILES notation for 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide?
The canonical SMILES for 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide is COc1c(O)cc(CCNC(=O)C(N)CO)cc1O.
What is the InChIKey of 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide?
The InChIKey is VQDVRRHFKRMVEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O5/c1-19-11-9(16)4-7(5-10(11)17)2-3-14-12(18)8(13)6-15/h4-5,8,15-17H,2-3,6,13H2,1H3,(H,14,18).
What are the key properties of 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide?
2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide has a molecular weight of 270.28 g/mol, XLogP of -0.92, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[2-(3,5-dihydroxy-4-methoxyphenyl)ethyl]-3-hydroxypropanamide is sourced from PubChem (CID 166986947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).