C17H20ClNO2S — CID 74889903
methyl (2S)-2-amino-3-benzhydrylsulfanylpropanoate;hydrochloride (PubChem CID 74889903) has the molecular formula C17H20ClNO2S and a molecular weight of 337.87 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-benzhydrylsulfanylpropanoate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-3-benzhydrylsulfanylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 74889903 |
| Molecular Formula | C17H20ClNO2S |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | methyl (2S)-2-amino-3-benzhydrylsulfanylpropanoate;hydrochloride |
| SMILES | COC(=O)[C@H](N)CSC(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C17H19NO2S.ClH/c1-20-17(19)15(18)12-21-16(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11,15-16H,12,18H2,1H3;1H/t15-;/m1./s1 |
| InChIKey | ZYKFPEBBJHQAAR-XFULWGLBSA-N |
| XLogP | 3.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |