About 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate
2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate (PubChem CID 157317285) has the molecular formula C15H23N3O6S2
and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate.
Molecular Properties
| Compound Name | 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate |
| PubChem CID | 157317285 |
| Molecular Formula | C15H23N3O6S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate |
| SMILES | COC(=O)C(N)CSSCC(N)C(=O)OC.Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C8H16N2O4S2.C7H7NO2/c1-13-7(11)5(9)3-15-16-4-6(10)8(12)14-2;8-6-4-2-1-3-5(6)7(9)10/h5-6H,3-4,9-10H2,1-2H3;1-4H,8H2,(H,9,10) |
| InChIKey | BDTGOFOJLXZEAZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate?
The IUPAC name of 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate (CID 157317285) is 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate.
What is the SMILES notation for 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate?
The canonical SMILES for 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate is COC(=O)C(N)CSSCC(N)C(=O)OC.Nc1ccccc1C(=O)O.
What is the InChIKey of 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate?
The InChIKey is BDTGOFOJLXZEAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4S2.C7H7NO2/c1-13-7(11)5(9)3-15-16-4-6(10)8(12)14-2;8-6-4-2-1-3-5(6)7(9)10/h5-6H,3-4,9-10H2,1-2H3;1-4H,8H2,(H,9,10).
What are the key properties of 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate?
2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate has a molecular weight of 405.50 g/mol, XLogP of 0.34, 8 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzoic acid;methyl 2-amino-3-[(2-amino-3-methoxy-3-oxopropyl)disulfanyl]propanoate is sourced from PubChem (CID 157317285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).