C24H32N4O6S2 — CID 160688138
hydrazine;methyl 4-(2-aminophenyl)-2-[[[4-(2-aminophenyl)-2-methoxycarbonyl-4-oxobutyl]disulfanyl]methyl]-4-oxobutanoate (PubChem CID 160688138) has the molecular formula C24H32N4O6S2 and a molecular weight of 536.68 g/mol. Its IUPAC name is hydrazine;methyl 4-(2-aminophenyl)-2-[[[4-(2-aminophenyl)-2-methoxycarbonyl-4-oxobutyl]disulfanyl]methyl]-4-oxobutanoate.
| Compound Name | hydrazine;methyl 4-(2-aminophenyl)-2-[[[4-(2-aminophenyl)-2-methoxycarbonyl-4-oxobutyl]disulfanyl]methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 160688138 |
| Molecular Formula | C24H32N4O6S2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | hydrazine;methyl 4-(2-aminophenyl)-2-[[[4-(2-aminophenyl)-2-methoxycarbonyl-4-oxobutyl]disulfanyl]methyl]-4-oxobutanoate |
| SMILES | COC(=O)C(CSSCC(CC(=O)c1ccccc1N)C(=O)OC)CC(=O)c1ccccc1N.NN |
| InChI | InChI=1S/C24H28N2O6S2.H4N2/c1-31-23(29)15(11-21(27)17-7-3-5-9-19(17)25)13-33-34-14-16(24(30)32-2)12-22(28)18-8-4-6-10-20(18)26;1-2/h3-10,15-16H,11-14,25-26H2,1-2H3;1-2H2 |
| InChIKey | RPATXKHMLQMIRB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 190.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|