C36H36N4O7S — CID 99654103
2-[[2-[[2-[[(2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]acetyl]amino]acetyl]amino]acetic acid (PubChem CID 99654103) has the molecular formula C36H36N4O7S and a molecular weight of 668.77 g/mol. Its IUPAC name is 2-[[2-[[2-[[(2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]acetyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[(2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 99654103 |
| Molecular Formula | C36H36N4O7S |
| Molecular Weight | 668.77 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | 2-[[2-[[2-[[(2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]acetyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)CNC(=O)[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H36N4O7S/c41-31(38-23-33(43)44)21-37-32(42)22-39-34(45)30(40-35(46)47-24-26-13-5-1-6-14-26)25-48-36(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-20,30H,21-25H2,(H,37,42)(H,38,41)(H,39,45)(H,40,46)(H,43,44)/t30-/m1/s1 |
| InChIKey | BBRQMKNGUIIRBT-SSEXGKCCSA-N |
| XLogP | 3.44 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.77 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|