C40H42N2O6S — CID 159828634
benzyl N-[(3S)-6-[[(2R)-3,6-dioxo-1-tritylsulfanylheptan-2-yl]amino]-2,6-dioxohexan-3-yl]carbamate (PubChem CID 159828634) has the molecular formula C40H42N2O6S and a molecular weight of 678.85 g/mol. Its IUPAC name is benzyl N-[(3S)-6-[[(2R)-3,6-dioxo-1-tritylsulfanylheptan-2-yl]amino]-2,6-dioxohexan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-6-[[(2R)-3,6-dioxo-1-tritylsulfanylheptan-2-yl]amino]-2,6-dioxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 159828634 |
| Molecular Formula | C40H42N2O6S |
| Molecular Weight | 678.85 g/mol |
| Exact Mass | 678.28 |
| IUPAC Name | benzyl N-[(3S)-6-[[(2R)-3,6-dioxo-1-tritylsulfanylheptan-2-yl]amino]-2,6-dioxohexan-3-yl]carbamate |
| SMILES | CC(=O)CCC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(C)=O |
| InChI | InChI=1S/C40H42N2O6S/c1-29(43)23-25-37(45)36(41-38(46)26-24-35(30(2)44)42-39(47)48-27-31-15-7-3-8-16-31)28-49-40(32-17-9-4-10-18-32,33-19-11-5-12-20-33)34-21-13-6-14-22-34/h3-22,35-36H,23-28H2,1-2H3,(H,41,46)(H,42,47)/t35-,36-/m0/s1 |
| InChIKey | MZCKIJAGBQTDON-ZPGRZCPFSA-N |
| XLogP | 6.80 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.85 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|