C43H41N3O8S — CID 66557882
(2S)-5-[[(2R)-1-[[(R)-carboxy(phenyl)methyl]amino]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 66557882) has the molecular formula C43H41N3O8S and a molecular weight of 759.88 g/mol. Its IUPAC name is (2S)-5-[[(2R)-1-[[(R)-carboxy(phenyl)methyl]amino]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2S)-5-[[(2R)-1-[[(R)-carboxy(phenyl)methyl]amino]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 66557882 |
| Molecular Formula | C43H41N3O8S |
| Molecular Weight | 759.88 g/mol |
| Exact Mass | 759.26 |
| IUPAC Name | (2S)-5-[[(2R)-1-[[(R)-carboxy(phenyl)methyl]amino]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(CC[C@H](NC(=O)OCc1ccccc1)C(=O)O)N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C43H41N3O8S/c47-37(27-26-35(40(49)50)45-42(53)54-28-30-16-6-1-7-17-30)44-36(39(48)46-38(41(51)52)31-18-8-2-9-19-31)29-55-43(32-20-10-3-11-21-32,33-22-12-4-13-23-33)34-24-14-5-15-25-34/h1-25,35-36,38H,26-29H2,(H,44,47)(H,45,53)(H,46,48)(H,49,50)(H,51,52)/t35-,36-,38+/m0/s1 |
| InChIKey | RPWXETUQKJPEOY-CYAOVYSGSA-N |
| XLogP | 6.30 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.88 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|