C52H53N3O6S2 — CID 99653206
tert-butyl 2-[[(2S)-3-benzhydrylsulfanyl-2-[[(2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]acetate (PubChem CID 99653206) has the molecular formula C52H53N3O6S2 and a molecular weight of 880.14 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-3-benzhydrylsulfanyl-2-[[(2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(2S)-3-benzhydrylsulfanyl-2-[[(2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 99653206 |
| Molecular Formula | C52H53N3O6S2 |
| Molecular Weight | 880.14 g/mol |
| Exact Mass | 879.34 |
| IUPAC Name | tert-butyl 2-[[(2S)-3-benzhydrylsulfanyl-2-[[(2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)[C@@H](CSC(c1ccccc1)c1ccccc1)NC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C52H53N3O6S2/c1-51(2,3)61-46(56)34-53-48(57)44(36-62-47(39-24-12-5-13-25-39)40-26-14-6-15-27-40)54-49(58)45(55-50(59)60-35-38-22-10-4-11-23-38)37-63-52(41-28-16-7-17-29-41,42-30-18-8-19-31-42)43-32-20-9-21-33-43/h4-33,44-45,47H,34-37H2,1-3H3,(H,53,57)(H,54,58)(H,55,59)/t44-,45+/m1/s1 |
| InChIKey | CAEKOLNKYNIEFG-UVTBUIGASA-N |
| XLogP | 9.47 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.14 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|