C61H55N3O6S2 — CID 99654088
benzhydryl 2-[[(2R)-3-benzhydrylsulfanyl-2-[[(2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]acetate (PubChem CID 99654088) has the molecular formula C61H55N3O6S2 and a molecular weight of 990.26 g/mol. Its IUPAC name is benzhydryl 2-[[(2R)-3-benzhydrylsulfanyl-2-[[(2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]acetate.
| Compound Name | benzhydryl 2-[[(2R)-3-benzhydrylsulfanyl-2-[[(2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 99654088 |
| Molecular Formula | C61H55N3O6S2 |
| Molecular Weight | 990.26 g/mol |
| Exact Mass | 989.35 |
| IUPAC Name | benzhydryl 2-[[(2R)-3-benzhydrylsulfanyl-2-[[(2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]acetate |
| SMILES | O=C(CNC(=O)[C@H](CSC(c1ccccc1)c1ccccc1)NC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCc1ccccc1)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C61H55N3O6S2/c65-55(70-56(46-27-11-2-12-28-46)47-29-13-3-14-30-47)41-62-58(66)53(43-71-57(48-31-15-4-16-32-48)49-33-17-5-18-34-49)63-59(67)54(64-60(68)69-42-45-25-9-1-10-26-45)44-72-61(50-35-19-6-20-36-50,51-37-21-7-22-38-51)52-39-23-8-24-40-52/h1-40,53-54,56-57H,41-44H2,(H,62,66)(H,63,67)(H,64,68)/t53-,54-/m0/s1 |
| InChIKey | JYHYQVXGDRSISB-PJYGOTMFSA-N |
| XLogP | 11.46 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.26 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|