C17H23N3 — CID 15319690
N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine (PubChem CID 15319690) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine.
| Compound Name | N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 15319690 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine |
| SMILES | NCCNCCCNc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H23N3/c18-11-14-19-12-4-13-20-17-9-7-16(8-10-17)15-5-2-1-3-6-15/h1-3,5-10,19-20H,4,11-14,18H2 |
| InChIKey | HFJRZJHJOYASLC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|