About N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine
N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine (PubChem CID 15319690) has the molecular formula C17H23N3
and a molecular weight of 269.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine |
| PubChem CID | 15319690 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine |
| SMILES | NCCNCCCNc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H23N3/c18-11-14-19-12-4-13-20-17-9-7-16(8-10-17)15-5-2-1-3-6-15/h1-3,5-10,19-20H,4,11-14,18H2 |
| InChIKey | HFJRZJHJOYASLC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine?
The IUPAC name of N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine (CID 15319690) is N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine.
What is the SMILES notation for N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine?
The canonical SMILES for N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine is NCCNCCCNc1ccc(-c2ccccc2)cc1.
What is the InChIKey of N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine?
The InChIKey is HFJRZJHJOYASLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3/c18-11-14-19-12-4-13-20-17-9-7-16(8-10-17)15-5-2-1-3-6-15/h1-3,5-10,19-20H,4,11-14,18H2.
What are the key properties of N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine?
N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine has a molecular weight of 269.39 g/mol, XLogP of 2.70, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-(4-phenylphenyl)propane-1,3-diamine is sourced from PubChem (CID 15319690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).