C17H12F7NO3S — CID 101477254
(2,3,4,5,6-pentafluorophenyl) 4-[(3,3-difluoropyrrolidin-1-yl)methyl]benzenesulfonate (PubChem CID 101477254) has the molecular formula C17H12F7NO3S and a molecular weight of 443.34 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[(3,3-difluoropyrrolidin-1-yl)methyl]benzenesulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[(3,3-difluoropyrrolidin-1-yl)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 101477254 |
| Molecular Formula | C17H12F7NO3S |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[(3,3-difluoropyrrolidin-1-yl)methyl]benzenesulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(CN2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C17H12F7NO3S/c18-11-12(19)14(21)16(15(22)13(11)20)28-29(26,27)10-3-1-9(2-4-10)7-25-6-5-17(23,24)8-25/h1-4H,5-8H2 |
| InChIKey | QGNLLLNTZJMQGV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|