C25H22F3NO2S — CID 68535890
3,3-difluoro-1-[[2-[4-[2-(4-fluorophenyl)ethenyl]phenyl]sulfonylphenyl]methyl]pyrrolidine (PubChem CID 68535890) has the molecular formula C25H22F3NO2S and a molecular weight of 457.52 g/mol. Its IUPAC name is 3,3-difluoro-1-[[2-[4-[2-(4-fluorophenyl)ethenyl]phenyl]sulfonylphenyl]methyl]pyrrolidine.
| Compound Name | 3,3-difluoro-1-[[2-[4-[2-(4-fluorophenyl)ethenyl]phenyl]sulfonylphenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 68535890 |
| Molecular Formula | C25H22F3NO2S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 3,3-difluoro-1-[[2-[4-[2-(4-fluorophenyl)ethenyl]phenyl]sulfonylphenyl]methyl]pyrrolidine |
| SMILES | O=S(=O)(c1ccc(C=Cc2ccc(F)cc2)cc1)c1ccccc1CN1CCC(F)(F)C1 |
| InChI | InChI=1S/C25H22F3NO2S/c26-22-11-7-19(8-12-22)5-6-20-9-13-23(14-10-20)32(30,31)24-4-2-1-3-21(24)17-29-16-15-25(27,28)18-29/h1-14H,15-18H2 |
| InChIKey | DBOBLYRHYJYBJG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|