C25H23F2NO3S — CID 68535723
4-[[3-[4-[2-(2,4-difluorophenyl)ethenyl]phenyl]sulfonylphenyl]methyl]morpholine (PubChem CID 68535723) has the molecular formula C25H23F2NO3S and a molecular weight of 455.53 g/mol. Its IUPAC name is 4-[[3-[4-[2-(2,4-difluorophenyl)ethenyl]phenyl]sulfonylphenyl]methyl]morpholine.
| Compound Name | 4-[[3-[4-[2-(2,4-difluorophenyl)ethenyl]phenyl]sulfonylphenyl]methyl]morpholine |
|---|---|
| PubChem CID | 68535723 |
| Molecular Formula | C25H23F2NO3S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-[[3-[4-[2-(2,4-difluorophenyl)ethenyl]phenyl]sulfonylphenyl]methyl]morpholine |
| SMILES | O=S(=O)(c1ccc(C=Cc2ccc(F)cc2F)cc1)c1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C25H23F2NO3S/c26-22-9-8-21(25(27)17-22)7-4-19-5-10-23(11-6-19)32(29,30)24-3-1-2-20(16-24)18-28-12-14-31-15-13-28/h1-11,16-17H,12-15,18H2 |
| InChIKey | LSVVBFXYSBYICX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|