C20H13BrF2O2S — CID 68533166
1-[2-[4-(3-bromophenyl)sulfonylphenyl]ethenyl]-2,4-difluorobenzene (PubChem CID 68533166) has the molecular formula C20H13BrF2O2S and a molecular weight of 435.29 g/mol. Its IUPAC name is 1-[2-[4-(3-bromophenyl)sulfonylphenyl]ethenyl]-2,4-difluorobenzene.
| Compound Name | 1-[2-[4-(3-bromophenyl)sulfonylphenyl]ethenyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 68533166 |
| Molecular Formula | C20H13BrF2O2S |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | 1-[2-[4-(3-bromophenyl)sulfonylphenyl]ethenyl]-2,4-difluorobenzene |
| SMILES | O=S(=O)(c1ccc(C=Cc2ccc(F)cc2F)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H13BrF2O2S/c21-16-2-1-3-19(12-16)26(24,25)18-10-5-14(6-11-18)4-7-15-8-9-17(22)13-20(15)23/h1-13H |
| InChIKey | ZQNIPWSATFZSOH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|