C23H20F2O3S — CID 68530629
2-[2-[4-[2-(2,4-difluorophenyl)ethenyl]phenyl]sulfonylphenyl]propan-2-ol (PubChem CID 68530629) has the molecular formula C23H20F2O3S and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[2-[4-[2-(2,4-difluorophenyl)ethenyl]phenyl]sulfonylphenyl]propan-2-ol.
| Compound Name | 2-[2-[4-[2-(2,4-difluorophenyl)ethenyl]phenyl]sulfonylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 68530629 |
| Molecular Formula | C23H20F2O3S |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-[2-[4-[2-(2,4-difluorophenyl)ethenyl]phenyl]sulfonylphenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccccc1S(=O)(=O)c1ccc(C=Cc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C23H20F2O3S/c1-23(2,26)20-5-3-4-6-22(20)29(27,28)19-13-8-16(9-14-19)7-10-17-11-12-18(24)15-21(17)25/h3-15,26H,1-2H3 |
| InChIKey | UAFSTLOGGBLSQS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|