C20H18ClNO5S3 — CID 2271274
[2-chloro-4-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 2271274) has the molecular formula C20H18ClNO5S3 and a molecular weight of 484.02 g/mol. Its IUPAC name is [2-chloro-4-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-chloro-4-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2271274 |
| Molecular Formula | C20H18ClNO5S3 |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | [2-chloro-4-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | CCN1C(=O)/C(=C\c2cc(Cl)c(OS(=O)(=O)c3ccc(C)cc3)c(OC)c2)SC1=S |
| InChI | InChI=1S/C20H18ClNO5S3/c1-4-22-19(23)17(29-20(22)28)11-13-9-15(21)18(16(10-13)26-3)27-30(24,25)14-7-5-12(2)6-8-14/h5-11H,4H2,1-3H3/b17-11+ |
| InChIKey | SCFZVUBIXUGBGH-GZTJUZNOSA-N |
| XLogP | 4.65 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|