C23H29F2N5O2 — CID 101069119
[2,3-difluoro-4-(4-heptylpiperazin-1-yl)phenyl]-(4-nitrophenyl)diazene (PubChem CID 101069119) has the molecular formula C23H29F2N5O2 and a molecular weight of 445.51 g/mol. Its IUPAC name is [2,3-difluoro-4-(4-heptylpiperazin-1-yl)phenyl]-(4-nitrophenyl)diazene.
| Compound Name | [2,3-difluoro-4-(4-heptylpiperazin-1-yl)phenyl]-(4-nitrophenyl)diazene |
|---|---|
| PubChem CID | 101069119 |
| Molecular Formula | C23H29F2N5O2 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [2,3-difluoro-4-(4-heptylpiperazin-1-yl)phenyl]-(4-nitrophenyl)diazene |
| SMILES | CCCCCCCN1CCN(c2ccc(/N=N/c3ccc([N+](=O)[O-])cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C23H29F2N5O2/c1-2-3-4-5-6-13-28-14-16-29(17-15-28)21-12-11-20(22(24)23(21)25)27-26-18-7-9-19(10-8-18)30(31)32/h7-12H,2-6,13-17H2,1H3/b27-26+ |
| InChIKey | CPIMSRCYLYKPJE-CYYJNZCTSA-N |
| XLogP | 6.38 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|