C19H31NO — CID 66685872
4-(3-but-1-enoxypropyl)-N,N-dipropylaniline (PubChem CID 66685872) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 4-(3-but-1-enoxypropyl)-N,N-dipropylaniline.
| Compound Name | 4-(3-but-1-enoxypropyl)-N,N-dipropylaniline |
|---|---|
| PubChem CID | 66685872 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 4-(3-but-1-enoxypropyl)-N,N-dipropylaniline |
| SMILES | CCC=COCCCc1ccc(N(CCC)CCC)cc1 |
| InChI | InChI=1S/C19H31NO/c1-4-7-16-21-17-8-9-18-10-12-19(13-11-18)20(14-5-2)15-6-3/h7,10-13,16H,4-6,8-9,14-15,17H2,1-3H3 |
| InChIKey | KWPQUMJBAGGFSS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|