C59H84N4 — CID 22095487
4-N-[4-[bis[4-(dibutylamino)phenyl]methyl]phenyl]-1-N,1-N-dibutyl-4-N-(4-butylphenyl)benzene-1,4-diamine (PubChem CID 22095487) has the molecular formula C59H84N4 and a molecular weight of 849.35 g/mol. Its IUPAC name is 4-N-[4-[bis[4-(dibutylamino)phenyl]methyl]phenyl]-1-N,1-N-dibutyl-4-N-(4-butylphenyl)benzene-1,4-diamine.
| Compound Name | 4-N-[4-[bis[4-(dibutylamino)phenyl]methyl]phenyl]-1-N,1-N-dibutyl-4-N-(4-butylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 22095487 |
| Molecular Formula | C59H84N4 |
| Molecular Weight | 849.35 g/mol |
| Exact Mass | 848.67 |
| IUPAC Name | 4-N-[4-[bis[4-(dibutylamino)phenyl]methyl]phenyl]-1-N,1-N-dibutyl-4-N-(4-butylphenyl)benzene-1,4-diamine |
| SMILES | CCCCc1ccc(N(c2ccc(C(c3ccc(N(CCCC)CCCC)cc3)c3ccc(N(CCCC)CCCC)cc3)cc2)c2ccc(N(CCCC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C59H84N4/c1-8-15-22-49-23-31-56(32-24-49)63(58-41-39-55(40-42-58)62(47-20-13-6)48-21-14-7)57-37-29-52(30-38-57)59(50-25-33-53(34-26-50)60(43-16-9-2)44-17-10-3)51-27-35-54(36-28-51)61(45-18-11-4)46-19-12-5/h23-42,59H,8-22,43-48H2,1-7H3 |
| InChIKey | UDPCVYHONXMICC-UHFFFAOYSA-N |
| XLogP | 16.90 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.35 |
| LogP ≤ 5 | 16.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|