C28H41F3N4O3 — CID 143876267
ethane;4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethyl]amino]pentanamide (PubChem CID 143876267) has the molecular formula C28H41F3N4O3 and a molecular weight of 538.66 g/mol. Its IUPAC name is ethane;4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethyl]amino]pentanamide.
| Compound Name | ethane;4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 143876267 |
| Molecular Formula | C28H41F3N4O3 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | ethane;4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethyl]amino]pentanamide |
| SMILES | CC.CC(C)CC(NC(c1ccc(O)cc1)C(F)(F)F)C(=O)NCCNc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H35F3N4O3.C2H6/c1-18(2)17-23(32-24(26(27,28)29)19-3-9-22(34)10-4-19)25(35)31-12-11-30-20-5-7-21(8-6-20)33-13-15-36-16-14-33;1-2/h3-10,18,23-24,30,32,34H,11-17H2,1-2H3,(H,31,35);1-2H3 |
| InChIKey | CFBYNTJTHMKPNI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|