C33H44F3N5OS — CID 52911637
N-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]ethyl]-4-methyl-2-[[2,2,2-trifluoro-1-(4-thiophen-3-ylphenyl)ethyl]amino]pentanamide (PubChem CID 52911637) has the molecular formula C33H44F3N5OS and a molecular weight of 615.81 g/mol. Its IUPAC name is N-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]ethyl]-4-methyl-2-[[2,2,2-trifluoro-1-(4-thiophen-3-ylphenyl)ethyl]amino]pentanamide.
| Compound Name | N-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]ethyl]-4-methyl-2-[[2,2,2-trifluoro-1-(4-thiophen-3-ylphenyl)ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 52911637 |
| Molecular Formula | C33H44F3N5OS |
| Molecular Weight | 615.81 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | N-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]ethyl]-4-methyl-2-[[2,2,2-trifluoro-1-(4-thiophen-3-ylphenyl)ethyl]amino]pentanamide |
| SMILES | CC(C)CC(NC(c1ccc(-c2ccsc2)cc1)C(F)(F)F)C(=O)NCCNc1ccc(N2CCC(N(C)C)CC2)cc1 |
| InChI | InChI=1S/C33H44F3N5OS/c1-23(2)21-30(39-31(33(34,35)36)25-7-5-24(6-8-25)26-15-20-43-22-26)32(42)38-17-16-37-27-9-11-29(12-10-27)41-18-13-28(14-19-41)40(3)4/h5-12,15,20,22-23,28,30-31,37,39H,13-14,16-19,21H2,1-4H3,(H,38,42) |
| InChIKey | DJSNLOOYFHWMBE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.81 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|