C35H46F3N5O4 — CID 143876270
benzyl N-methylcarbamate;4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide (PubChem CID 143876270) has the molecular formula C35H46F3N5O4 and a molecular weight of 657.78 g/mol. Its IUPAC name is benzyl N-methylcarbamate;4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide.
| Compound Name | benzyl N-methylcarbamate;4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide |
|---|---|
| PubChem CID | 143876270 |
| Molecular Formula | C35H46F3N5O4 |
| Molecular Weight | 657.78 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | benzyl N-methylcarbamate;4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pentanamide |
| SMILES | CC(C)CC(NC(c1ccccc1)C(F)(F)F)C(=O)NCCNc1ccc(N2CCOCC2)cc1.CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H35F3N4O2.C9H11NO2/c1-19(2)18-23(32-24(26(27,28)29)20-6-4-3-5-7-20)25(34)31-13-12-30-21-8-10-22(11-9-21)33-14-16-35-17-15-33;1-10-9(11)12-7-8-5-3-2-4-6-8/h3-11,19,23-24,30,32H,12-18H2,1-2H3,(H,31,34);2-6H,7H2,1H3,(H,10,11) |
| InChIKey | HYNUJSABFOUGLT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.78 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|